C10H14BrFN2O4S — CID 106181683
5-amino-4-bromo-2-fluoro-N-(1-hydroxy-3-methoxypropan-2-yl)benzenesulfonamide (PubChem CID 106181683) has the molecular formula C10H14BrFN2O4S and a molecular weight of 357.20 g/mol. Its IUPAC name is 5-amino-4-bromo-2-fluoro-N-(1-hydroxy-3-methoxypropan-2-yl)benzenesulfonamide.
| Compound Name | 5-amino-4-bromo-2-fluoro-N-(1-hydroxy-3-methoxypropan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 106181683 |
| Molecular Formula | C10H14BrFN2O4S |
| Molecular Weight | 357.20 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | 5-amino-4-bromo-2-fluoro-N-(1-hydroxy-3-methoxypropan-2-yl)benzenesulfonamide |
| SMILES | COCC(CO)NS(=O)(=O)c1cc(N)c(Br)cc1F |
| InChI | InChI=1S/C10H14BrFN2O4S/c1-18-5-6(4-15)14-19(16,17)10-3-9(13)7(11)2-8(10)12/h2-3,6,14-15H,4-5,13H2,1H3 |
| InChIKey | GREFZZLMCRAHFF-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.20 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|