C11H16BrFN2O3S — CID 104889698
5-amino-4-bromo-2-fluoro-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]benzenesulfonamide (PubChem CID 104889698) has the molecular formula C11H16BrFN2O3S and a molecular weight of 355.23 g/mol. Its IUPAC name is 5-amino-4-bromo-2-fluoro-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]benzenesulfonamide.
| Compound Name | 5-amino-4-bromo-2-fluoro-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 104889698 |
| Molecular Formula | C11H16BrFN2O3S |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 5-amino-4-bromo-2-fluoro-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]benzenesulfonamide |
| SMILES | CC(C)[C@@H](CO)NS(=O)(=O)c1cc(N)c(Br)cc1F |
| InChI | InChI=1S/C11H16BrFN2O3S/c1-6(2)10(5-16)15-19(17,18)11-4-9(14)7(12)3-8(11)13/h3-4,6,10,15-16H,5,14H2,1-2H3/t10-/m1/s1 |
| InChIKey | QKOMEYGDNFEZRF-SNVBAGLBSA-N |
| XLogP | 1.47 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|