C11H16FN3O4S — CID 65192922
N-(1-amino-3-methylbutan-2-yl)-4-fluoro-2-nitrobenzenesulfonamide (PubChem CID 65192922) has the molecular formula C11H16FN3O4S and a molecular weight of 305.33 g/mol. Its IUPAC name is N-(1-amino-3-methylbutan-2-yl)-4-fluoro-2-nitrobenzenesulfonamide.
| Compound Name | N-(1-amino-3-methylbutan-2-yl)-4-fluoro-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 65192922 |
| Molecular Formula | C11H16FN3O4S |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | N-(1-amino-3-methylbutan-2-yl)-4-fluoro-2-nitrobenzenesulfonamide |
| SMILES | CC(C)C(CN)NS(=O)(=O)c1ccc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H16FN3O4S/c1-7(2)9(6-13)14-20(18,19)11-4-3-8(12)5-10(11)15(16)17/h3-5,7,9,14H,6,13H2,1-2H3 |
| InChIKey | JABYMPCCMGWMAE-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|