C11H15IN2O4 — CID 106157577
3-(2-iodo-4-nitroanilino)-4-methoxybutan-1-ol (PubChem CID 106157577) has the molecular formula C11H15IN2O4 and a molecular weight of 366.16 g/mol. Its IUPAC name is 3-(2-iodo-4-nitroanilino)-4-methoxybutan-1-ol.
| Compound Name | 3-(2-iodo-4-nitroanilino)-4-methoxybutan-1-ol |
|---|---|
| PubChem CID | 106157577 |
| Molecular Formula | C11H15IN2O4 |
| Molecular Weight | 366.16 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | 3-(2-iodo-4-nitroanilino)-4-methoxybutan-1-ol |
| SMILES | COCC(CCO)Nc1ccc([N+](=O)[O-])cc1I |
| InChI | InChI=1S/C11H15IN2O4/c1-18-7-8(4-5-15)13-11-3-2-9(14(16)17)6-10(11)12/h2-3,6,8,13,15H,4-5,7H2,1H3 |
| InChIKey | XLHKZOIJTNJVHM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.16 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|