C12H15N3O3S — CID 95775364
2-[[(2R)-4-hydroxy-1-methylsulfanylbutan-2-yl]amino]-5-nitrobenzonitrile (PubChem CID 95775364) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is 2-[[(2R)-4-hydroxy-1-methylsulfanylbutan-2-yl]amino]-5-nitrobenzonitrile.
| Compound Name | 2-[[(2R)-4-hydroxy-1-methylsulfanylbutan-2-yl]amino]-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 95775364 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-[[(2R)-4-hydroxy-1-methylsulfanylbutan-2-yl]amino]-5-nitrobenzonitrile |
| SMILES | CSC[C@@H](CCO)Nc1ccc([N+](=O)[O-])cc1C#N |
| InChI | InChI=1S/C12H15N3O3S/c1-19-8-10(4-5-16)14-12-3-2-11(15(17)18)6-9(12)7-13/h2-3,6,10,14,16H,4-5,8H2,1H3/t10-/m1/s1 |
| InChIKey | UVAQRHSSPPMONR-SNVBAGLBSA-N |
| XLogP | 1.99 |
| TPSA | 99.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|