C12H18IN3O2 — CID 80704672
2-N-(2-iodo-4-nitrophenyl)hexane-1,2-diamine (PubChem CID 80704672) has the molecular formula C12H18IN3O2 and a molecular weight of 363.20 g/mol. Its IUPAC name is 2-N-(2-iodo-4-nitrophenyl)hexane-1,2-diamine.
| Compound Name | 2-N-(2-iodo-4-nitrophenyl)hexane-1,2-diamine |
|---|---|
| PubChem CID | 80704672 |
| Molecular Formula | C12H18IN3O2 |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | 2-N-(2-iodo-4-nitrophenyl)hexane-1,2-diamine |
| SMILES | CCCCC(CN)Nc1ccc([N+](=O)[O-])cc1I |
| InChI | InChI=1S/C12H18IN3O2/c1-2-3-4-9(8-14)15-12-6-5-10(16(17)18)7-11(12)13/h5-7,9,15H,2-4,8,14H2,1H3 |
| InChIKey | JWRHANFFDYLCSL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|