C12H16F3NO4S — CID 115755279
N-(1-hydroxypentan-3-yl)-3-(trifluoromethoxy)benzenesulfonamide (PubChem CID 115755279) has the molecular formula C12H16F3NO4S and a molecular weight of 327.32 g/mol. Its IUPAC name is N-(1-hydroxypentan-3-yl)-3-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-(1-hydroxypentan-3-yl)-3-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 115755279 |
| Molecular Formula | C12H16F3NO4S |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | N-(1-hydroxypentan-3-yl)-3-(trifluoromethoxy)benzenesulfonamide |
| SMILES | CCC(CCO)NS(=O)(=O)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C12H16F3NO4S/c1-2-9(6-7-17)16-21(18,19)11-5-3-4-10(8-11)20-12(13,14)15/h3-5,8-9,16-17H,2,6-7H2,1H3 |
| InChIKey | IJHSJSOJYRIIGY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |