C11H17FN2O3S — CID 114163152
N-(3-amino-4-methoxybutyl)-3-fluorobenzenesulfonamide (PubChem CID 114163152) has the molecular formula C11H17FN2O3S and a molecular weight of 276.33 g/mol. Its IUPAC name is N-(3-amino-4-methoxybutyl)-3-fluorobenzenesulfonamide.
| Compound Name | N-(3-amino-4-methoxybutyl)-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 114163152 |
| Molecular Formula | C11H17FN2O3S |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | N-(3-amino-4-methoxybutyl)-3-fluorobenzenesulfonamide |
| SMILES | COCC(N)CCNS(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C11H17FN2O3S/c1-17-8-10(13)5-6-14-18(15,16)11-4-2-3-9(12)7-11/h2-4,7,10,14H,5-6,8,13H2,1H3 |
| InChIKey | ZBCDKQVLORYNAY-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |