C10H18N2O5S — CID 106245527
5-[[(3-hydroxy-4-methoxybutyl)amino]methyl]furan-2-sulfonamide (PubChem CID 106245527) has the molecular formula C10H18N2O5S and a molecular weight of 278.33 g/mol. Its IUPAC name is 5-[[(3-hydroxy-4-methoxybutyl)amino]methyl]furan-2-sulfonamide.
| Compound Name | 5-[[(3-hydroxy-4-methoxybutyl)amino]methyl]furan-2-sulfonamide |
|---|---|
| PubChem CID | 106245527 |
| Molecular Formula | C10H18N2O5S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 5-[[(3-hydroxy-4-methoxybutyl)amino]methyl]furan-2-sulfonamide |
| SMILES | COCC(O)CCNCc1ccc(S(N)(=O)=O)o1 |
| InChI | InChI=1S/C10H18N2O5S/c1-16-7-8(13)4-5-12-6-9-2-3-10(17-9)18(11,14)15/h2-3,8,12-13H,4-7H2,1H3,(H2,11,14,15) |
| InChIKey | SWYVZUXXQSTHOJ-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|