C8H13N3O5S — CID 83210287
2-[(5-sulfamoylfuran-2-yl)methylamino]ethyl carbamate (PubChem CID 83210287) has the molecular formula C8H13N3O5S and a molecular weight of 263.27 g/mol. Its IUPAC name is 2-[(5-sulfamoylfuran-2-yl)methylamino]ethyl carbamate.
| Compound Name | 2-[(5-sulfamoylfuran-2-yl)methylamino]ethyl carbamate |
|---|---|
| PubChem CID | 83210287 |
| Molecular Formula | C8H13N3O5S |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 2-[(5-sulfamoylfuran-2-yl)methylamino]ethyl carbamate |
| SMILES | NC(=O)OCCNCc1ccc(S(N)(=O)=O)o1 |
| InChI | InChI=1S/C8H13N3O5S/c9-8(12)15-4-3-11-5-6-1-2-7(16-6)17(10,13)14/h1-2,11H,3-5H2,(H2,9,12)(H2,10,13,14) |
| InChIKey | LUDFDMXGYZSHCV-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 137.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|