C12H21N3O4S — CID 106233401
5-[[5-(dimethylsulfamoyl)furan-2-yl]methylamino]pentanamide (PubChem CID 106233401) has the molecular formula C12H21N3O4S and a molecular weight of 303.38 g/mol. Its IUPAC name is 5-[[5-(dimethylsulfamoyl)furan-2-yl]methylamino]pentanamide.
| Compound Name | 5-[[5-(dimethylsulfamoyl)furan-2-yl]methylamino]pentanamide |
|---|---|
| PubChem CID | 106233401 |
| Molecular Formula | C12H21N3O4S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 5-[[5-(dimethylsulfamoyl)furan-2-yl]methylamino]pentanamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(CNCCCCC(N)=O)o1 |
| InChI | InChI=1S/C12H21N3O4S/c1-15(2)20(17,18)12-7-6-10(19-12)9-14-8-4-3-5-11(13)16/h6-7,14H,3-5,8-9H2,1-2H3,(H2,13,16) |
| InChIKey | XCAMAJUHDCVLDD-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|