C11H20N2O4S — CID 106158296
5-[[(5-hydroxy-4-methylpentyl)amino]methyl]furan-2-sulfonamide (PubChem CID 106158296) has the molecular formula C11H20N2O4S and a molecular weight of 276.36 g/mol. Its IUPAC name is 5-[[(5-hydroxy-4-methylpentyl)amino]methyl]furan-2-sulfonamide.
| Compound Name | 5-[[(5-hydroxy-4-methylpentyl)amino]methyl]furan-2-sulfonamide |
|---|---|
| PubChem CID | 106158296 |
| Molecular Formula | C11H20N2O4S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 5-[[(5-hydroxy-4-methylpentyl)amino]methyl]furan-2-sulfonamide |
| SMILES | CC(CO)CCCNCc1ccc(S(N)(=O)=O)o1 |
| InChI | InChI=1S/C11H20N2O4S/c1-9(8-14)3-2-6-13-7-10-4-5-11(17-10)18(12,15)16/h4-5,9,13-14H,2-3,6-8H2,1H3,(H2,12,15,16) |
| InChIKey | KVIOFKYDJDPGNC-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|