C14H27N3O3S — CID 106040255
N,N-dimethyl-5-[[3-[methyl(propan-2-yl)amino]propylamino]methyl]furan-2-sulfonamide (PubChem CID 106040255) has the molecular formula C14H27N3O3S and a molecular weight of 317.46 g/mol. Its IUPAC name is N,N-dimethyl-5-[[3-[methyl(propan-2-yl)amino]propylamino]methyl]furan-2-sulfonamide.
| Compound Name | N,N-dimethyl-5-[[3-[methyl(propan-2-yl)amino]propylamino]methyl]furan-2-sulfonamide |
|---|---|
| PubChem CID | 106040255 |
| Molecular Formula | C14H27N3O3S |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | N,N-dimethyl-5-[[3-[methyl(propan-2-yl)amino]propylamino]methyl]furan-2-sulfonamide |
| SMILES | CC(C)N(C)CCCNCc1ccc(S(=O)(=O)N(C)C)o1 |
| InChI | InChI=1S/C14H27N3O3S/c1-12(2)17(5)10-6-9-15-11-13-7-8-14(20-13)21(18,19)16(3)4/h7-8,12,15H,6,9-11H2,1-5H3 |
| InChIKey | ZANUSQFVFOOQDC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|