C13H24N2O3S2 — CID 115988547
N-methyl-N-(1-methylsulfanylpropan-2-yl)-5-(propylaminomethyl)furan-2-sulfonamide (PubChem CID 115988547) has the molecular formula C13H24N2O3S2 and a molecular weight of 320.48 g/mol. Its IUPAC name is N-methyl-N-(1-methylsulfanylpropan-2-yl)-5-(propylaminomethyl)furan-2-sulfonamide.
| Compound Name | N-methyl-N-(1-methylsulfanylpropan-2-yl)-5-(propylaminomethyl)furan-2-sulfonamide |
|---|---|
| PubChem CID | 115988547 |
| Molecular Formula | C13H24N2O3S2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | N-methyl-N-(1-methylsulfanylpropan-2-yl)-5-(propylaminomethyl)furan-2-sulfonamide |
| SMILES | CCCNCc1ccc(S(=O)(=O)N(C)C(C)CSC)o1 |
| InChI | InChI=1S/C13H24N2O3S2/c1-5-8-14-9-12-6-7-13(18-12)20(16,17)15(3)11(2)10-19-4/h6-7,11,14H,5,8-10H2,1-4H3 |
| InChIKey | TUAREXNDJKPQOP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|