C11H21N3O3S — CID 83025121
N',N'-dimethyl-5-[(2-methylpropylamino)methyl]furan-2-sulfonohydrazide (PubChem CID 83025121) has the molecular formula C11H21N3O3S and a molecular weight of 275.37 g/mol. Its IUPAC name is N',N'-dimethyl-5-[(2-methylpropylamino)methyl]furan-2-sulfonohydrazide.
| Compound Name | N',N'-dimethyl-5-[(2-methylpropylamino)methyl]furan-2-sulfonohydrazide |
|---|---|
| PubChem CID | 83025121 |
| Molecular Formula | C11H21N3O3S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N',N'-dimethyl-5-[(2-methylpropylamino)methyl]furan-2-sulfonohydrazide |
| SMILES | CC(C)CNCc1ccc(S(=O)(=O)NN(C)C)o1 |
| InChI | InChI=1S/C11H21N3O3S/c1-9(2)7-12-8-10-5-6-11(17-10)18(15,16)13-14(3)4/h5-6,9,12-13H,7-8H2,1-4H3 |
| InChIKey | WXOGGNWTOLTBHN-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|