C14H26N2O4S — CID 104766789
N-(2-methoxy-2-methylpropyl)-5-[(2-methylpropylamino)methyl]furan-2-sulfonamide (PubChem CID 104766789) has the molecular formula C14H26N2O4S and a molecular weight of 318.44 g/mol. Its IUPAC name is N-(2-methoxy-2-methylpropyl)-5-[(2-methylpropylamino)methyl]furan-2-sulfonamide.
| Compound Name | N-(2-methoxy-2-methylpropyl)-5-[(2-methylpropylamino)methyl]furan-2-sulfonamide |
|---|---|
| PubChem CID | 104766789 |
| Molecular Formula | C14H26N2O4S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | N-(2-methoxy-2-methylpropyl)-5-[(2-methylpropylamino)methyl]furan-2-sulfonamide |
| SMILES | COC(C)(C)CNS(=O)(=O)c1ccc(CNCC(C)C)o1 |
| InChI | InChI=1S/C14H26N2O4S/c1-11(2)8-15-9-12-6-7-13(20-12)21(17,18)16-10-14(3,4)19-5/h6-7,11,15-16H,8-10H2,1-5H3 |
| InChIKey | DUVDPGJTLJIYNO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |