C12H22N2O5S — CID 102701246
5-[(2-methoxyethylamino)methyl]-N-(2-methoxypropyl)furan-2-sulfonamide (PubChem CID 102701246) has the molecular formula C12H22N2O5S and a molecular weight of 306.38 g/mol. Its IUPAC name is 5-[(2-methoxyethylamino)methyl]-N-(2-methoxypropyl)furan-2-sulfonamide.
| Compound Name | 5-[(2-methoxyethylamino)methyl]-N-(2-methoxypropyl)furan-2-sulfonamide |
|---|---|
| PubChem CID | 102701246 |
| Molecular Formula | C12H22N2O5S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 5-[(2-methoxyethylamino)methyl]-N-(2-methoxypropyl)furan-2-sulfonamide |
| SMILES | COCCNCc1ccc(S(=O)(=O)NCC(C)OC)o1 |
| InChI | InChI=1S/C12H22N2O5S/c1-10(18-3)8-14-20(15,16)12-5-4-11(19-12)9-13-6-7-17-2/h4-5,10,13-14H,6-9H2,1-3H3 |
| InChIKey | QXDRSFKCWKPCAP-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|