C13H22N2O4S — CID 106410034
N-(2-but-3-enoxyethyl)-5-(ethylaminomethyl)furan-2-sulfonamide (PubChem CID 106410034) has the molecular formula C13H22N2O4S and a molecular weight of 302.40 g/mol. Its IUPAC name is N-(2-but-3-enoxyethyl)-5-(ethylaminomethyl)furan-2-sulfonamide.
| Compound Name | N-(2-but-3-enoxyethyl)-5-(ethylaminomethyl)furan-2-sulfonamide |
|---|---|
| PubChem CID | 106410034 |
| Molecular Formula | C13H22N2O4S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | N-(2-but-3-enoxyethyl)-5-(ethylaminomethyl)furan-2-sulfonamide |
| SMILES | C=CCCOCCNS(=O)(=O)c1ccc(CNCC)o1 |
| InChI | InChI=1S/C13H22N2O4S/c1-3-5-9-18-10-8-15-20(16,17)13-7-6-12(19-13)11-14-4-2/h3,6-7,14-15H,1,4-5,8-11H2,2H3 |
| InChIKey | LSZMKEMWAKJIOH-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|