C13H24N2O5S — CID 81063705
N-(2-ethoxyethyl)-5-[(2-methoxyethylamino)methyl]-N-methylfuran-2-sulfonamide (PubChem CID 81063705) has the molecular formula C13H24N2O5S and a molecular weight of 320.41 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-5-[(2-methoxyethylamino)methyl]-N-methylfuran-2-sulfonamide.
| Compound Name | N-(2-ethoxyethyl)-5-[(2-methoxyethylamino)methyl]-N-methylfuran-2-sulfonamide |
|---|---|
| PubChem CID | 81063705 |
| Molecular Formula | C13H24N2O5S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | N-(2-ethoxyethyl)-5-[(2-methoxyethylamino)methyl]-N-methylfuran-2-sulfonamide |
| SMILES | CCOCCN(C)S(=O)(=O)c1ccc(CNCCOC)o1 |
| InChI | InChI=1S/C13H24N2O5S/c1-4-19-10-8-15(2)21(16,17)13-6-5-12(20-13)11-14-7-9-18-3/h5-6,14H,4,7-11H2,1-3H3 |
| InChIKey | HKJCQHBCQOHLFZ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|