C13H23NO6S — CID 82940209
N,N-bis(2-ethoxyethyl)-5-(hydroxymethyl)furan-2-sulfonamide (PubChem CID 82940209) has the molecular formula C13H23NO6S and a molecular weight of 321.40 g/mol. Its IUPAC name is N,N-bis(2-ethoxyethyl)-5-(hydroxymethyl)furan-2-sulfonamide.
| Compound Name | N,N-bis(2-ethoxyethyl)-5-(hydroxymethyl)furan-2-sulfonamide |
|---|---|
| PubChem CID | 82940209 |
| Molecular Formula | C13H23NO6S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | N,N-bis(2-ethoxyethyl)-5-(hydroxymethyl)furan-2-sulfonamide |
| SMILES | CCOCCN(CCOCC)S(=O)(=O)c1ccc(CO)o1 |
| InChI | InChI=1S/C13H23NO6S/c1-3-18-9-7-14(8-10-19-4-2)21(16,17)13-6-5-12(11-15)20-13/h5-6,15H,3-4,7-11H2,1-2H3 |
| InChIKey | ATHKSCHNOCIYHH-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|