C19H33NO4S — CID 3706171
N,N-bis(2-ethoxyethyl)-2,3,4,5,6-pentamethylbenzenesulfonamide (PubChem CID 3706171) has the molecular formula C19H33NO4S and a molecular weight of 371.54 g/mol. Its IUPAC name is N,N-bis(2-ethoxyethyl)-2,3,4,5,6-pentamethylbenzenesulfonamide.
| Compound Name | N,N-bis(2-ethoxyethyl)-2,3,4,5,6-pentamethylbenzenesulfonamide |
|---|---|
| PubChem CID | 3706171 |
| Molecular Formula | C19H33NO4S |
| Molecular Weight | 371.54 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | N,N-bis(2-ethoxyethyl)-2,3,4,5,6-pentamethylbenzenesulfonamide |
| SMILES | CCOCCN(CCOCC)S(=O)(=O)c1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C19H33NO4S/c1-8-23-12-10-20(11-13-24-9-2)25(21,22)19-17(6)15(4)14(3)16(5)18(19)7/h8-13H2,1-7H3 |
| InChIKey | NGVTVOBTZLHGEH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.54 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|