C10H24N2O4S — CID 82952398
2-amino-N,N-bis(2-ethoxyethyl)ethanesulfonamide (PubChem CID 82952398) has the molecular formula C10H24N2O4S and a molecular weight of 268.38 g/mol. Its IUPAC name is 2-amino-N,N-bis(2-ethoxyethyl)ethanesulfonamide.
| Compound Name | 2-amino-N,N-bis(2-ethoxyethyl)ethanesulfonamide |
|---|---|
| PubChem CID | 82952398 |
| Molecular Formula | C10H24N2O4S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 2-amino-N,N-bis(2-ethoxyethyl)ethanesulfonamide |
| SMILES | CCOCCN(CCOCC)S(=O)(=O)CCN |
| InChI | InChI=1S/C10H24N2O4S/c1-3-15-8-6-12(7-9-16-4-2)17(13,14)10-5-11/h3-11H2,1-2H3 |
| InChIKey | MIKJJPANKXDNGC-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|