C13H30N2O4S — CID 82951040
N,N-bis(2-ethoxyethyl)-2-(propan-2-ylamino)ethanesulfonamide (PubChem CID 82951040) has the molecular formula C13H30N2O4S and a molecular weight of 310.46 g/mol. Its IUPAC name is N,N-bis(2-ethoxyethyl)-2-(propan-2-ylamino)ethanesulfonamide.
| Compound Name | N,N-bis(2-ethoxyethyl)-2-(propan-2-ylamino)ethanesulfonamide |
|---|---|
| PubChem CID | 82951040 |
| Molecular Formula | C13H30N2O4S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | N,N-bis(2-ethoxyethyl)-2-(propan-2-ylamino)ethanesulfonamide |
| SMILES | CCOCCN(CCOCC)S(=O)(=O)CCNC(C)C |
| InChI | InChI=1S/C13H30N2O4S/c1-5-18-10-8-15(9-11-19-6-2)20(16,17)12-7-14-13(3)4/h13-14H,5-12H2,1-4H3 |
| InChIKey | ZDBLFSPDWXHODA-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|