C12H28N2O4S — CID 82953041
N,N-bis(2-ethoxyethyl)-1-(methylamino)propane-2-sulfonamide (PubChem CID 82953041) has the molecular formula C12H28N2O4S and a molecular weight of 296.43 g/mol. Its IUPAC name is N,N-bis(2-ethoxyethyl)-1-(methylamino)propane-2-sulfonamide.
| Compound Name | N,N-bis(2-ethoxyethyl)-1-(methylamino)propane-2-sulfonamide |
|---|---|
| PubChem CID | 82953041 |
| Molecular Formula | C12H28N2O4S |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | N,N-bis(2-ethoxyethyl)-1-(methylamino)propane-2-sulfonamide |
| SMILES | CCOCCN(CCOCC)S(=O)(=O)C(C)CNC |
| InChI | InChI=1S/C12H28N2O4S/c1-5-17-9-7-14(8-10-18-6-2)19(15,16)12(3)11-13-4/h12-13H,5-11H2,1-4H3 |
| InChIKey | BXWYIJVBTOVQFM-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|