C11H26N2O4S — CID 82953278
1-amino-N,N-bis(2-ethoxyethyl)propane-2-sulfonamide (PubChem CID 82953278) has the molecular formula C11H26N2O4S and a molecular weight of 282.41 g/mol. Its IUPAC name is 1-amino-N,N-bis(2-ethoxyethyl)propane-2-sulfonamide.
| Compound Name | 1-amino-N,N-bis(2-ethoxyethyl)propane-2-sulfonamide |
|---|---|
| PubChem CID | 82953278 |
| Molecular Formula | C11H26N2O4S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 1-amino-N,N-bis(2-ethoxyethyl)propane-2-sulfonamide |
| SMILES | CCOCCN(CCOCC)S(=O)(=O)C(C)CN |
| InChI | InChI=1S/C11H26N2O4S/c1-4-16-8-6-13(7-9-17-5-2)18(14,15)11(3)10-12/h11H,4-10,12H2,1-3H3 |
| InChIKey | IJRAFQDMXJGEOG-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|