C30H48N4O8S2 — CID 5380153
5-amino-2-[(Z)-2-[4-amino-2-[bis(2-ethoxyethyl)sulfamoyl]phenyl]ethenyl]-N,N-bis(2-ethoxyethyl)benzenesulfonamide (PubChem CID 5380153) has the molecular formula C30H48N4O8S2 and a molecular weight of 656.87 g/mol. Its IUPAC name is 5-amino-2-[(Z)-2-[4-amino-2-[bis(2-ethoxyethyl)sulfamoyl]phenyl]ethenyl]-N,N-bis(2-ethoxyethyl)benzenesulfonamide.
| Compound Name | 5-amino-2-[(Z)-2-[4-amino-2-[bis(2-ethoxyethyl)sulfamoyl]phenyl]ethenyl]-N,N-bis(2-ethoxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 5380153 |
| Molecular Formula | C30H48N4O8S2 |
| Molecular Weight | 656.87 g/mol |
| Exact Mass | 656.29 |
| IUPAC Name | 5-amino-2-[(Z)-2-[4-amino-2-[bis(2-ethoxyethyl)sulfamoyl]phenyl]ethenyl]-N,N-bis(2-ethoxyethyl)benzenesulfonamide |
| SMILES | CCOCCN(CCOCC)S(=O)(=O)c1cc(N)ccc1/C=C\c1ccc(N)cc1S(=O)(=O)N(CCOCC)CCOCC |
| InChI | InChI=1S/C30H48N4O8S2/c1-5-39-19-15-33(16-20-40-6-2)43(35,36)29-23-27(31)13-11-25(29)9-10-26-12-14-28(32)24-30(26)44(37,38)34(17-21-41-7-3)18-22-42-8-4/h9-14,23-24H,5-8,15-22,31-32H2,1-4H3/b10-9- |
| InChIKey | HVHZMNWWGFXTDI-KTKRTIGZSA-N |
| XLogP | 3.15 |
| TPSA | 163.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.87 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|