C12H19N3O5S — CID 63691664
4-amino-N-(2-ethoxyethyl)-N-ethyl-2-nitrobenzenesulfonamide (PubChem CID 63691664) has the molecular formula C12H19N3O5S and a molecular weight of 317.37 g/mol. Its IUPAC name is 4-amino-N-(2-ethoxyethyl)-N-ethyl-2-nitrobenzenesulfonamide.
| Compound Name | 4-amino-N-(2-ethoxyethyl)-N-ethyl-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 63691664 |
| Molecular Formula | C12H19N3O5S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 4-amino-N-(2-ethoxyethyl)-N-ethyl-2-nitrobenzenesulfonamide |
| SMILES | CCOCCN(CC)S(=O)(=O)c1ccc(N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H19N3O5S/c1-3-14(7-8-20-4-2)21(18,19)12-6-5-10(13)9-11(12)15(16)17/h5-6,9H,3-4,7-8,13H2,1-2H3 |
| InChIKey | ICIUQIRQXVPNAJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|