C16H27NO2S — CID 3332180
N-butyl-N,2,3,4,5,6-hexamethylbenzenesulfonamide (PubChem CID 3332180) has the molecular formula C16H27NO2S and a molecular weight of 297.46 g/mol. Its IUPAC name is N-butyl-N,2,3,4,5,6-hexamethylbenzenesulfonamide.
| Compound Name | N-butyl-N,2,3,4,5,6-hexamethylbenzenesulfonamide |
|---|---|
| PubChem CID | 3332180 |
| Molecular Formula | C16H27NO2S |
| Molecular Weight | 297.46 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | N-butyl-N,2,3,4,5,6-hexamethylbenzenesulfonamide |
| SMILES | CCCCN(C)S(=O)(=O)c1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C16H27NO2S/c1-8-9-10-17(7)20(18,19)16-14(5)12(3)11(2)13(4)15(16)6/h8-10H2,1-7H3 |
| InChIKey | YEGCNORPTZVZOW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |