C12H22N2O4S — CID 102998456
N-[3-(dimethylamino)propyl]-N-ethyl-5-(hydroxymethyl)furan-2-sulfonamide (PubChem CID 102998456) has the molecular formula C12H22N2O4S and a molecular weight of 290.38 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-N-ethyl-5-(hydroxymethyl)furan-2-sulfonamide.
| Compound Name | N-[3-(dimethylamino)propyl]-N-ethyl-5-(hydroxymethyl)furan-2-sulfonamide |
|---|---|
| PubChem CID | 102998456 |
| Molecular Formula | C12H22N2O4S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-N-ethyl-5-(hydroxymethyl)furan-2-sulfonamide |
| SMILES | CCN(CCCN(C)C)S(=O)(=O)c1ccc(CO)o1 |
| InChI | InChI=1S/C12H22N2O4S/c1-4-14(9-5-8-13(2)3)19(16,17)12-7-6-11(10-15)18-12/h6-7,15H,4-5,8-10H2,1-3H3 |
| InChIKey | HPLXNHUDOYHZNR-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |