C14H26N2O2S3 — CID 115988696
N,4-dimethyl-N-(1-methylsulfanylpropan-2-yl)-5-(propylaminomethyl)thiophene-2-sulfonamide (PubChem CID 115988696) has the molecular formula C14H26N2O2S3 and a molecular weight of 350.58 g/mol. Its IUPAC name is N,4-dimethyl-N-(1-methylsulfanylpropan-2-yl)-5-(propylaminomethyl)thiophene-2-sulfonamide.
| Compound Name | N,4-dimethyl-N-(1-methylsulfanylpropan-2-yl)-5-(propylaminomethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 115988696 |
| Molecular Formula | C14H26N2O2S3 |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | N,4-dimethyl-N-(1-methylsulfanylpropan-2-yl)-5-(propylaminomethyl)thiophene-2-sulfonamide |
| SMILES | CCCNCc1sc(S(=O)(=O)N(C)C(C)CSC)cc1C |
| InChI | InChI=1S/C14H26N2O2S3/c1-6-7-15-9-13-11(2)8-14(20-13)21(17,18)16(4)12(3)10-19-5/h8,12,15H,6-7,9-10H2,1-5H3 |
| InChIKey | OCUPEHAQLCQLKW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|