C11H18ClNO2S3 — CID 112667165
5-(chloromethyl)-N,2-dimethyl-N-(1-methylsulfanylpropan-2-yl)thiophene-3-sulfonamide (PubChem CID 112667165) has the molecular formula C11H18ClNO2S3 and a molecular weight of 327.92 g/mol. Its IUPAC name is 5-(chloromethyl)-N,2-dimethyl-N-(1-methylsulfanylpropan-2-yl)thiophene-3-sulfonamide.
| Compound Name | 5-(chloromethyl)-N,2-dimethyl-N-(1-methylsulfanylpropan-2-yl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 112667165 |
| Molecular Formula | C11H18ClNO2S3 |
| Molecular Weight | 327.92 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 5-(chloromethyl)-N,2-dimethyl-N-(1-methylsulfanylpropan-2-yl)thiophene-3-sulfonamide |
| SMILES | CSCC(C)N(C)S(=O)(=O)c1cc(CCl)sc1C |
| InChI | InChI=1S/C11H18ClNO2S3/c1-8(7-16-4)13(3)18(14,15)11-5-10(6-12)17-9(11)2/h5,8H,6-7H2,1-4H3 |
| InChIKey | JIYPPNLIDDAQNL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.92 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|