C12H16Cl3NO2S2 — CID 115988222
2,4-dichloro-5-(chloromethyl)-N-methyl-N-(1-methylsulfanylpropan-2-yl)benzenesulfonamide (PubChem CID 115988222) has the molecular formula C12H16Cl3NO2S2 and a molecular weight of 376.76 g/mol. Its IUPAC name is 2,4-dichloro-5-(chloromethyl)-N-methyl-N-(1-methylsulfanylpropan-2-yl)benzenesulfonamide.
| Compound Name | 2,4-dichloro-5-(chloromethyl)-N-methyl-N-(1-methylsulfanylpropan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 115988222 |
| Molecular Formula | C12H16Cl3NO2S2 |
| Molecular Weight | 376.76 g/mol |
| Exact Mass | 374.97 |
| IUPAC Name | 2,4-dichloro-5-(chloromethyl)-N-methyl-N-(1-methylsulfanylpropan-2-yl)benzenesulfonamide |
| SMILES | CSCC(C)N(C)S(=O)(=O)c1cc(CCl)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H16Cl3NO2S2/c1-8(7-19-3)16(2)20(17,18)12-4-9(6-13)10(14)5-11(12)15/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | LUHSRNCTXLXXKB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.76 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|