C13H18Cl3NO2S2 — CID 115988184
2,4-dichloro-5-(chloromethyl)-N-methyl-N-(1-methylsulfanylbutan-2-yl)benzenesulfonamide (PubChem CID 115988184) has the molecular formula C13H18Cl3NO2S2 and a molecular weight of 390.79 g/mol. Its IUPAC name is 2,4-dichloro-5-(chloromethyl)-N-methyl-N-(1-methylsulfanylbutan-2-yl)benzenesulfonamide.
| Compound Name | 2,4-dichloro-5-(chloromethyl)-N-methyl-N-(1-methylsulfanylbutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 115988184 |
| Molecular Formula | C13H18Cl3NO2S2 |
| Molecular Weight | 390.79 g/mol |
| Exact Mass | 388.98 |
| IUPAC Name | 2,4-dichloro-5-(chloromethyl)-N-methyl-N-(1-methylsulfanylbutan-2-yl)benzenesulfonamide |
| SMILES | CCC(CSC)N(C)S(=O)(=O)c1cc(CCl)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H18Cl3NO2S2/c1-4-10(8-20-3)17(2)21(18,19)13-5-9(7-14)11(15)6-12(13)16/h5-6,10H,4,7-8H2,1-3H3 |
| InChIKey | WZDVGODSHKBPCT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.79 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|