C10H18N4O2S2 — CID 112664023
2-amino-N-methyl-N-(1-methylsulfanylbutan-2-yl)pyrimidine-5-sulfonamide (PubChem CID 112664023) has the molecular formula C10H18N4O2S2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 2-amino-N-methyl-N-(1-methylsulfanylbutan-2-yl)pyrimidine-5-sulfonamide.
| Compound Name | 2-amino-N-methyl-N-(1-methylsulfanylbutan-2-yl)pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 112664023 |
| Molecular Formula | C10H18N4O2S2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2-amino-N-methyl-N-(1-methylsulfanylbutan-2-yl)pyrimidine-5-sulfonamide |
| SMILES | CCC(CSC)N(C)S(=O)(=O)c1cnc(N)nc1 |
| InChI | InChI=1S/C10H18N4O2S2/c1-4-8(7-17-3)14(2)18(15,16)9-5-12-10(11)13-6-9/h5-6,8H,4,7H2,1-3H3,(H2,11,12,13) |
| InChIKey | NBQBBKRIFKYZHY-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |