C13H22N2O2S2 — CID 112656640
2-amino-N,4-dimethyl-N-(1-methylsulfanylbutan-2-yl)benzenesulfonamide (PubChem CID 112656640) has the molecular formula C13H22N2O2S2 and a molecular weight of 302.47 g/mol. Its IUPAC name is 2-amino-N,4-dimethyl-N-(1-methylsulfanylbutan-2-yl)benzenesulfonamide.
| Compound Name | 2-amino-N,4-dimethyl-N-(1-methylsulfanylbutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 112656640 |
| Molecular Formula | C13H22N2O2S2 |
| Molecular Weight | 302.47 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-amino-N,4-dimethyl-N-(1-methylsulfanylbutan-2-yl)benzenesulfonamide |
| SMILES | CCC(CSC)N(C)S(=O)(=O)c1ccc(C)cc1N |
| InChI | InChI=1S/C13H22N2O2S2/c1-5-11(9-18-4)15(3)19(16,17)13-7-6-10(2)8-12(13)14/h6-8,11H,5,9,14H2,1-4H3 |
| InChIKey | KNKWJUYLGIUAGI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.47 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|