C12H17Cl2NO3S — CID 107091002
3-chloro-4-(chloromethyl)-N-(1-methoxypropan-2-yl)-N-methylbenzenesulfonamide (PubChem CID 107091002) has the molecular formula C12H17Cl2NO3S and a molecular weight of 326.25 g/mol. Its IUPAC name is 3-chloro-4-(chloromethyl)-N-(1-methoxypropan-2-yl)-N-methylbenzenesulfonamide.
| Compound Name | 3-chloro-4-(chloromethyl)-N-(1-methoxypropan-2-yl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 107091002 |
| Molecular Formula | C12H17Cl2NO3S |
| Molecular Weight | 326.25 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 3-chloro-4-(chloromethyl)-N-(1-methoxypropan-2-yl)-N-methylbenzenesulfonamide |
| SMILES | COCC(C)N(C)S(=O)(=O)c1ccc(CCl)c(Cl)c1 |
| InChI | InChI=1S/C12H17Cl2NO3S/c1-9(8-18-3)15(2)19(16,17)11-5-4-10(7-13)12(14)6-11/h4-6,9H,7-8H2,1-3H3 |
| InChIKey | VOEBKDAYAPJYCT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|