C13H22N2O3S — CID 61452492
4-(1-aminoethyl)-N-(1-methoxypropan-2-yl)-N-methylbenzenesulfonamide (PubChem CID 61452492) has the molecular formula C13H22N2O3S and a molecular weight of 286.40 g/mol. Its IUPAC name is 4-(1-aminoethyl)-N-(1-methoxypropan-2-yl)-N-methylbenzenesulfonamide.
| Compound Name | 4-(1-aminoethyl)-N-(1-methoxypropan-2-yl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 61452492 |
| Molecular Formula | C13H22N2O3S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 4-(1-aminoethyl)-N-(1-methoxypropan-2-yl)-N-methylbenzenesulfonamide |
| SMILES | COCC(C)N(C)S(=O)(=O)c1ccc(C(C)N)cc1 |
| InChI | InChI=1S/C13H22N2O3S/c1-10(9-18-4)15(3)19(16,17)13-7-5-12(6-8-13)11(2)14/h5-8,10-11H,9,14H2,1-4H3 |
| InChIKey | KLRHAGOIFQNVRM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |