C14H19FN2O3S — CID 107652725
4-(3-aminoprop-1-ynyl)-3-fluoro-N-(1-methoxypropan-2-yl)-N-methylbenzenesulfonamide (PubChem CID 107652725) has the molecular formula C14H19FN2O3S and a molecular weight of 314.38 g/mol. Its IUPAC name is 4-(3-aminoprop-1-ynyl)-3-fluoro-N-(1-methoxypropan-2-yl)-N-methylbenzenesulfonamide.
| Compound Name | 4-(3-aminoprop-1-ynyl)-3-fluoro-N-(1-methoxypropan-2-yl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 107652725 |
| Molecular Formula | C14H19FN2O3S |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 4-(3-aminoprop-1-ynyl)-3-fluoro-N-(1-methoxypropan-2-yl)-N-methylbenzenesulfonamide |
| SMILES | COCC(C)N(C)S(=O)(=O)c1ccc(C#CCN)c(F)c1 |
| InChI | InChI=1S/C14H19FN2O3S/c1-11(10-20-3)17(2)21(18,19)13-7-6-12(5-4-8-16)14(15)9-13/h6-7,9,11H,8,10,16H2,1-3H3 |
| InChIKey | VJNLAKJPGKRYMS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|