C13H19Cl2NO2S — CID 107091072
3-chloro-4-(chloromethyl)-N-methyl-N-(2-methylbutan-2-yl)benzenesulfonamide (PubChem CID 107091072) has the molecular formula C13H19Cl2NO2S and a molecular weight of 324.27 g/mol. Its IUPAC name is 3-chloro-4-(chloromethyl)-N-methyl-N-(2-methylbutan-2-yl)benzenesulfonamide.
| Compound Name | 3-chloro-4-(chloromethyl)-N-methyl-N-(2-methylbutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 107091072 |
| Molecular Formula | C13H19Cl2NO2S |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 3-chloro-4-(chloromethyl)-N-methyl-N-(2-methylbutan-2-yl)benzenesulfonamide |
| SMILES | CCC(C)(C)N(C)S(=O)(=O)c1ccc(CCl)c(Cl)c1 |
| InChI | InChI=1S/C13H19Cl2NO2S/c1-5-13(2,3)16(4)19(17,18)11-7-6-10(9-14)12(15)8-11/h6-8H,5,9H2,1-4H3 |
| InChIKey | SWJMEQIAXKXVRE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|