C14H21Cl2NO3S — CID 107091030
N-butan-2-yl-3-chloro-4-(chloromethyl)-N-(2-methoxyethyl)benzenesulfonamide (PubChem CID 107091030) has the molecular formula C14H21Cl2NO3S and a molecular weight of 354.30 g/mol. Its IUPAC name is N-butan-2-yl-3-chloro-4-(chloromethyl)-N-(2-methoxyethyl)benzenesulfonamide.
| Compound Name | N-butan-2-yl-3-chloro-4-(chloromethyl)-N-(2-methoxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 107091030 |
| Molecular Formula | C14H21Cl2NO3S |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | N-butan-2-yl-3-chloro-4-(chloromethyl)-N-(2-methoxyethyl)benzenesulfonamide |
| SMILES | CCC(C)N(CCOC)S(=O)(=O)c1ccc(CCl)c(Cl)c1 |
| InChI | InChI=1S/C14H21Cl2NO3S/c1-4-11(2)17(7-8-20-3)21(18,19)13-6-5-12(10-15)14(16)9-13/h5-6,9,11H,4,7-8,10H2,1-3H3 |
| InChIKey | RIRAFTQZIQIBIC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|