C15H24ClNO3S — CID 82943175
3-(chloromethyl)-4-ethyl-N-(2-methoxyethyl)-N-propan-2-ylbenzenesulfonamide (PubChem CID 82943175) has the molecular formula C15H24ClNO3S and a molecular weight of 333.88 g/mol. Its IUPAC name is 3-(chloromethyl)-4-ethyl-N-(2-methoxyethyl)-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 3-(chloromethyl)-4-ethyl-N-(2-methoxyethyl)-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 82943175 |
| Molecular Formula | C15H24ClNO3S |
| Molecular Weight | 333.88 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 3-(chloromethyl)-4-ethyl-N-(2-methoxyethyl)-N-propan-2-ylbenzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)N(CCOC)C(C)C)cc1CCl |
| InChI | InChI=1S/C15H24ClNO3S/c1-5-13-6-7-15(10-14(13)11-16)21(18,19)17(12(2)3)8-9-20-4/h6-7,10,12H,5,8-9,11H2,1-4H3 |
| InChIKey | VWZFRTQYNFRNBB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.88 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|