C13H21FN2O3S — CID 82948850
3-(aminomethyl)-4-fluoro-N-(2-methoxyethyl)-N-propan-2-ylbenzenesulfonamide (PubChem CID 82948850) has the molecular formula C13H21FN2O3S and a molecular weight of 304.39 g/mol. Its IUPAC name is 3-(aminomethyl)-4-fluoro-N-(2-methoxyethyl)-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 3-(aminomethyl)-4-fluoro-N-(2-methoxyethyl)-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 82948850 |
| Molecular Formula | C13H21FN2O3S |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 3-(aminomethyl)-4-fluoro-N-(2-methoxyethyl)-N-propan-2-ylbenzenesulfonamide |
| SMILES | COCCN(C(C)C)S(=O)(=O)c1ccc(F)c(CN)c1 |
| InChI | InChI=1S/C13H21FN2O3S/c1-10(2)16(6-7-19-3)20(17,18)12-4-5-13(14)11(8-12)9-15/h4-5,8,10H,6-7,9,15H2,1-3H3 |
| InChIKey | NSKXXAUHEQNJIC-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |