C11H17FN2O2S — CID 63287989
3-(aminomethyl)-4-fluoro-N-methyl-N-propylbenzenesulfonamide (PubChem CID 63287989) has the molecular formula C11H17FN2O2S and a molecular weight of 260.33 g/mol. Its IUPAC name is 3-(aminomethyl)-4-fluoro-N-methyl-N-propylbenzenesulfonamide.
| Compound Name | 3-(aminomethyl)-4-fluoro-N-methyl-N-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 63287989 |
| Molecular Formula | C11H17FN2O2S |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 3-(aminomethyl)-4-fluoro-N-methyl-N-propylbenzenesulfonamide |
| SMILES | CCCN(C)S(=O)(=O)c1ccc(F)c(CN)c1 |
| InChI | InChI=1S/C11H17FN2O2S/c1-3-6-14(2)17(15,16)10-4-5-11(12)9(7-10)8-13/h4-5,7H,3,6,8,13H2,1-2H3 |
| InChIKey | ABDVPYNLAOXFGA-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |