C10H15FN2O2S — CID 82843782
4-amino-3-fluoro-N-methyl-N-propylbenzenesulfonamide (PubChem CID 82843782) has the molecular formula C10H15FN2O2S and a molecular weight of 246.31 g/mol. Its IUPAC name is 4-amino-3-fluoro-N-methyl-N-propylbenzenesulfonamide.
| Compound Name | 4-amino-3-fluoro-N-methyl-N-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 82843782 |
| Molecular Formula | C10H15FN2O2S |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 4-amino-3-fluoro-N-methyl-N-propylbenzenesulfonamide |
| SMILES | CCCN(C)S(=O)(=O)c1ccc(N)c(F)c1 |
| InChI | InChI=1S/C10H15FN2O2S/c1-3-6-13(2)16(14,15)8-4-5-10(12)9(11)7-8/h4-5,7H,3,6,12H2,1-2H3 |
| InChIKey | IXFWUBULFIVZTO-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|