C14H24FN3O2S — CID 82845498
4-amino-N-[2-(dimethylamino)ethyl]-3-fluoro-N-(2-methylpropyl)benzenesulfonamide (PubChem CID 82845498) has the molecular formula C14H24FN3O2S and a molecular weight of 317.43 g/mol. Its IUPAC name is 4-amino-N-[2-(dimethylamino)ethyl]-3-fluoro-N-(2-methylpropyl)benzenesulfonamide.
| Compound Name | 4-amino-N-[2-(dimethylamino)ethyl]-3-fluoro-N-(2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 82845498 |
| Molecular Formula | C14H24FN3O2S |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 4-amino-N-[2-(dimethylamino)ethyl]-3-fluoro-N-(2-methylpropyl)benzenesulfonamide |
| SMILES | CC(C)CN(CCN(C)C)S(=O)(=O)c1ccc(N)c(F)c1 |
| InChI | InChI=1S/C14H24FN3O2S/c1-11(2)10-18(8-7-17(3)4)21(19,20)12-5-6-14(16)13(15)9-12/h5-6,9,11H,7-8,10,16H2,1-4H3 |
| InChIKey | WZYVTZCNFUVUQH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|