C10H12BrCl2NO2S — CID 104556395
N-(1-bromopropan-2-yl)-3,4-dichloro-N-methylbenzenesulfonamide (PubChem CID 104556395) has the molecular formula C10H12BrCl2NO2S and a molecular weight of 361.09 g/mol. Its IUPAC name is N-(1-bromopropan-2-yl)-3,4-dichloro-N-methylbenzenesulfonamide.
| Compound Name | N-(1-bromopropan-2-yl)-3,4-dichloro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 104556395 |
| Molecular Formula | C10H12BrCl2NO2S |
| Molecular Weight | 361.09 g/mol |
| Exact Mass | 358.91 |
| IUPAC Name | N-(1-bromopropan-2-yl)-3,4-dichloro-N-methylbenzenesulfonamide |
| SMILES | CC(CBr)N(C)S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H12BrCl2NO2S/c1-7(6-11)14(2)17(15,16)8-3-4-9(12)10(13)5-8/h3-5,7H,6H2,1-2H3 |
| InChIKey | MIVXPYAFLBXCNU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.09 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|