C8H10Cl3NO2S2 — CID 104556518
2,5-dichloro-N-(1-chloropropan-2-yl)-N-methylthiophene-3-sulfonamide (PubChem CID 104556518) has the molecular formula C8H10Cl3NO2S2 and a molecular weight of 322.67 g/mol. Its IUPAC name is 2,5-dichloro-N-(1-chloropropan-2-yl)-N-methylthiophene-3-sulfonamide.
| Compound Name | 2,5-dichloro-N-(1-chloropropan-2-yl)-N-methylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 104556518 |
| Molecular Formula | C8H10Cl3NO2S2 |
| Molecular Weight | 322.67 g/mol |
| Exact Mass | 320.92 |
| IUPAC Name | 2,5-dichloro-N-(1-chloropropan-2-yl)-N-methylthiophene-3-sulfonamide |
| SMILES | CC(CCl)N(C)S(=O)(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C8H10Cl3NO2S2/c1-5(4-9)12(2)16(13,14)6-3-7(10)15-8(6)11/h3,5H,4H2,1-2H3 |
| InChIKey | DWPHSGKTTAPNLT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.67 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|