C10H13Cl2NO4S2 — CID 79269352
2-[tert-butyl-(2,5-dichlorothiophen-3-yl)sulfonylamino]acetic acid (PubChem CID 79269352) has the molecular formula C10H13Cl2NO4S2 and a molecular weight of 346.26 g/mol. Its IUPAC name is 2-[tert-butyl-(2,5-dichlorothiophen-3-yl)sulfonylamino]acetic acid.
| Compound Name | 2-[tert-butyl-(2,5-dichlorothiophen-3-yl)sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 79269352 |
| Molecular Formula | C10H13Cl2NO4S2 |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 344.97 |
| IUPAC Name | 2-[tert-butyl-(2,5-dichlorothiophen-3-yl)sulfonylamino]acetic acid |
| SMILES | CC(C)(C)N(CC(=O)O)S(=O)(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C10H13Cl2NO4S2/c1-10(2,3)13(5-8(14)15)19(16,17)6-4-7(11)18-9(6)12/h4H,5H2,1-3H3,(H,14,15) |
| InChIKey | ZGVCHEXWJLEODL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |