C12H14Cl3NO4S — CID 79262274
2-[tert-butyl-(2,4,6-trichlorophenyl)sulfonylamino]acetic acid (PubChem CID 79262274) has the molecular formula C12H14Cl3NO4S and a molecular weight of 374.67 g/mol. Its IUPAC name is 2-[tert-butyl-(2,4,6-trichlorophenyl)sulfonylamino]acetic acid.
| Compound Name | 2-[tert-butyl-(2,4,6-trichlorophenyl)sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 79262274 |
| Molecular Formula | C12H14Cl3NO4S |
| Molecular Weight | 374.67 g/mol |
| Exact Mass | 372.97 |
| IUPAC Name | 2-[tert-butyl-(2,4,6-trichlorophenyl)sulfonylamino]acetic acid |
| SMILES | CC(C)(C)N(CC(=O)O)S(=O)(=O)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C12H14Cl3NO4S/c1-12(2,3)16(6-10(17)18)21(19,20)11-8(14)4-7(13)5-9(11)15/h4-5H,6H2,1-3H3,(H,17,18) |
| InChIKey | GMFFHGQWDJYVGR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.67 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |