2,5-dichlorothiophene-3-sulfonic acid;hydrofluoride

C4H3Cl2FO3S2 — CID 174560905

IUPAC2,5-dichlorothiophene-3-sulfonic acid;hydrofluoride
SMILESF.O=S(=O)(O)c1cc(Cl)sc1Cl
InChIInChI=1S/C4H2Cl2O3S2.FH/c5-3-1-2(4(6)10-3)11(7,8)9;/h1H,(H,7,8,9);1H
InChIKeyDUXBETKWEWKAQT-UHFFFAOYSA-N
MW253.10 g/mol
LogP2.45
Rot. Bonds1

About 2,5-dichlorothiophene-3-sulfonic acid;hydrofluoride

2,5-dichlorothiophene-3-sulfonic acid;hydrofluoride (PubChem CID 174560905) has the molecular formula C4H3Cl2FO3S2 and a molecular weight of 253.10 g/mol. Its IUPAC name is 2,5-dichlorothiophene-3-sulfonic acid;hydrofluoride.

Molecular Properties

Compound Name2,5-dichlorothiophene-3-sulfonic acid;hydrofluoride
PubChem CID174560905
Molecular FormulaC4H3Cl2FO3S2
Molecular Weight253.10 g/mol
Exact Mass251.89
IUPAC Name2,5-dichlorothiophene-3-sulfonic acid;hydrofluoride
SMILESF.O=S(=O)(O)c1cc(Cl)sc1Cl
InChIInChI=1S/C4H2Cl2O3S2.FH/c5-3-1-2(4(6)10-3)11(7,8)9;/h1H,(H,7,8,9);1H
InChIKeyDUXBETKWEWKAQT-UHFFFAOYSA-N
XLogP2.45
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.10
LogP ≤ 52.45
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2,5-dichlorothiophene-3-sulfonic acid;hydrofluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-dichlorothiophene-3-sulfonic acid;hydrofluoride?
The IUPAC name of 2,5-dichlorothiophene-3-sulfonic acid;hydrofluoride (CID 174560905) is 2,5-dichlorothiophene-3-sulfonic acid;hydrofluoride.
What is the SMILES notation for 2,5-dichlorothiophene-3-sulfonic acid;hydrofluoride?
The canonical SMILES for 2,5-dichlorothiophene-3-sulfonic acid;hydrofluoride is F.O=S(=O)(O)c1cc(Cl)sc1Cl.
What is the InChIKey of 2,5-dichlorothiophene-3-sulfonic acid;hydrofluoride?
The InChIKey is DUXBETKWEWKAQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2Cl2O3S2.FH/c5-3-1-2(4(6)10-3)11(7,8)9;/h1H,(H,7,8,9);1H.
What are the key properties of 2,5-dichlorothiophene-3-sulfonic acid;hydrofluoride?
2,5-dichlorothiophene-3-sulfonic acid;hydrofluoride has a molecular weight of 253.10 g/mol, XLogP of 2.45, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dichlorothiophene-3-sulfonic acid;hydrofluoride is sourced from PubChem (CID 174560905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).